C20H23NO4S — CID 7981410
[(1R)-1-phenylethyl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 7981410) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(1R)-1-phenylethyl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7981410 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [(1R)-1-phenylethyl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | C[C@@H](OC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO4S/c1-16(17-9-4-2-5-10-17)25-20(22)18-11-8-12-19(15-18)26(23,24)21-13-6-3-7-14-21/h2,4-5,8-12,15-16H,3,6-7,13-14H2,1H3/t16-/m1/s1 |
| InChIKey | FUVCWHHAJODGMA-MRXNPFEDSA-N |
| XLogP | 3.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |