C21H26N2O3S — CID 9302186
N-[(2S)-2-phenylpropyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 9302186) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[(2S)-2-phenylpropyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(2S)-2-phenylpropyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9302186 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[(2S)-2-phenylpropyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | C[C@H](CNC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-17(18-9-4-2-5-10-18)16-22-21(24)19-11-8-12-20(15-19)27(25,26)23-13-6-3-7-14-23/h2,4-5,8-12,15,17H,3,6-7,13-14,16H2,1H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | XTGIVSPVDGGLFP-QGZVFWFLSA-N |
| XLogP | 3.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |