C18H29N3O3S — CID 120651231
3-(azepan-1-ylsulfonyl)-N-[(2R)-2-(ethylamino)propyl]benzamide (PubChem CID 120651231) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-[(2R)-2-(ethylamino)propyl]benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-[(2R)-2-(ethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 120651231 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-[(2R)-2-(ethylamino)propyl]benzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C18H29N3O3S/c1-3-19-15(2)14-20-18(22)16-9-8-10-17(13-16)25(23,24)21-11-6-4-5-7-12-21/h8-10,13,15,19H,3-7,11-12,14H2,1-2H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | DHUKKOXBIGLRRZ-OAHLLOKOSA-N |
| XLogP | 1.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |