C16H24N4O4S — CID 120653983
N-[(2R)-2-(ethylamino)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 120653983) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 120653983 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C16H24N4O4S/c1-3-17-12(2)10-19-16(22)13-5-4-6-14(9-13)25(23,24)20-8-7-18-15(21)11-20/h4-6,9,12,17H,3,7-8,10-11H2,1-2H3,(H,18,21)(H,19,22)/t12-/m1/s1 |
| InChIKey | ZHEZVRIOLQOQBY-GFCCVEGCSA-N |
| XLogP | -0.47 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |