C22H26N4O4S — CID 43071255
3-(3-oxopiperazin-1-yl)sulfonyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide (PubChem CID 43071255) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-(3-oxopiperazin-1-yl)sulfonyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43071255 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)NCC3CCN(c4ccccc4)C3)c2)CCN1 |
| InChI | InChI=1S/C22H26N4O4S/c27-21-16-26(12-10-23-21)31(29,30)20-8-4-5-18(13-20)22(28)24-14-17-9-11-25(15-17)19-6-2-1-3-7-19/h1-8,13,17H,9-12,14-16H2,(H,23,27)(H,24,28) |
| InChIKey | VVUDSZGIZNIZNL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |