C18H22N4O6S — CID 56558648
N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 56558648) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 56558648 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)NCCCN3C(=O)CCC3=O)c2)CCN1 |
| InChI | InChI=1S/C18H22N4O6S/c23-15-12-21(10-8-19-15)29(27,28)14-4-1-3-13(11-14)18(26)20-7-2-9-22-16(24)5-6-17(22)25/h1,3-4,11H,2,5-10,12H2,(H,19,23)(H,20,26) |
| InChIKey | XVSVJNATIIBYQZ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|