C22H23N5O4S — CID 43053709
3-(3-oxopiperazin-1-yl)sulfonyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide (PubChem CID 43053709) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is 3-(3-oxopiperazin-1-yl)sulfonyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide.
| Compound Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 43053709 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)NCCc3ccc(-n4cccn4)cc3)c2)CCN1 |
| InChI | InChI=1S/C22H23N5O4S/c28-21-16-26(14-12-23-21)32(30,31)20-4-1-3-18(15-20)22(29)24-11-9-17-5-7-19(8-6-17)27-13-2-10-25-27/h1-8,10,13,15H,9,11-12,14,16H2,(H,23,28)(H,24,29) |
| InChIKey | YWWMNTCWZJLFIW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |