C20H21N5O4S2 — CID 55635743
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 55635743) has the molecular formula C20H21N5O4S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55635743 |
| Molecular Formula | C20H21N5O4S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)NCCNc3nc4ccccc4s3)c2)CCN1 |
| InChI | InChI=1S/C20H21N5O4S2/c26-18-13-25(11-10-21-18)31(28,29)15-5-3-4-14(12-15)19(27)22-8-9-23-20-24-16-6-1-2-7-17(16)30-20/h1-7,12H,8-11,13H2,(H,21,26)(H,22,27)(H,23,24) |
| InChIKey | RMCGHUZSAGWZQE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|