C18H26N4O4S — CID 119559224
3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide (PubChem CID 119559224) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide.
| Compound Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 119559224 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)NCCC3CCCNC3)c2)CCN1 |
| InChI | InChI=1S/C18H26N4O4S/c23-17-13-22(10-9-20-17)27(25,26)16-5-1-4-15(11-16)18(24)21-8-6-14-3-2-7-19-12-14/h1,4-5,11,14,19H,2-3,6-10,12-13H2,(H,20,23)(H,21,24) |
| InChIKey | DADUASWNMKFUFR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |