C16H16ClN3O4S2 — CID 32833995
N-[(5-chlorothiophen-2-yl)methyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 32833995) has the molecular formula C16H16ClN3O4S2 and a molecular weight of 413.91 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 32833995 |
| Molecular Formula | C16H16ClN3O4S2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)NCc3ccc(Cl)s3)c2)CCN1 |
| InChI | InChI=1S/C16H16ClN3O4S2/c17-14-5-4-12(25-14)9-19-16(22)11-2-1-3-13(8-11)26(23,24)20-7-6-18-15(21)10-20/h1-5,8H,6-7,9-10H2,(H,18,21)(H,19,22) |
| InChIKey | TVVCKRYXTYXNDF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |