C20H21N5O4S — CID 43053716
N-(1-ethylbenzimidazol-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 43053716) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-(1-ethylbenzimidazol-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(1-ethylbenzimidazol-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 43053716 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-(1-ethylbenzimidazol-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | CCn1c(NC(=O)c2cccc(S(=O)(=O)N3CCNC(=O)C3)c2)nc2ccccc21 |
| InChI | InChI=1S/C20H21N5O4S/c1-2-25-17-9-4-3-8-16(17)22-20(25)23-19(27)14-6-5-7-15(12-14)30(28,29)24-11-10-21-18(26)13-24/h3-9,12H,2,10-11,13H2,1H3,(H,21,26)(H,22,23,27) |
| InChIKey | GJLRWHHXQHAVOJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |