C19H22N4O6S2 — CID 55985734
N-[2-(dimethylsulfamoyl)phenyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 55985734) has the molecular formula C19H22N4O6S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)phenyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(dimethylsulfamoyl)phenyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55985734 |
| Molecular Formula | C19H22N4O6S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)phenyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1NC(=O)c1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C19H22N4O6S2/c1-22(2)31(28,29)17-9-4-3-8-16(17)21-19(25)14-6-5-7-15(12-14)30(26,27)23-11-10-20-18(24)13-23/h3-9,12H,10-11,13H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | UWGKABMIFQNUAO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |