C20H23N5O4S — CID 30860962
3-(3-oxopiperazin-1-yl)sulfonyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)benzamide (PubChem CID 30860962) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-(3-oxopiperazin-1-yl)sulfonyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)benzamide.
| Compound Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 30860962 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)Nc3ccc(N4CCCC4)cn3)c2)CCN1 |
| InChI | InChI=1S/C20H23N5O4S/c26-19-14-25(11-8-21-19)30(28,29)17-5-3-4-15(12-17)20(27)23-18-7-6-16(13-22-18)24-9-1-2-10-24/h3-7,12-13H,1-2,8-11,14H2,(H,21,26)(H,22,23,27) |
| InChIKey | KKOSYZNHRZOKSG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |