C20H19N3O7S — CID 43053642
N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 43053642) has the molecular formula C20H19N3O7S and a molecular weight of 445.45 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 43053642 |
| Molecular Formula | C20H19N3O7S |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)c1cccc(S(=O)(=O)N3CCNC(=O)C3)c1)OCO2 |
| InChI | InChI=1S/C20H19N3O7S/c1-12(24)15-8-17-18(30-11-29-17)9-16(15)22-20(26)13-3-2-4-14(7-13)31(27,28)23-6-5-21-19(25)10-23/h2-4,7-9H,5-6,10-11H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | VGXOGYXBBVBZHX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |