C22H20N4O5S — CID 43068553
3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenoxy-3-pyridinyl)benzamide (PubChem CID 43068553) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is 3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenoxy-3-pyridinyl)benzamide.
| Compound Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 43068553 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenoxy-3-pyridinyl)benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)Nc3cccnc3Oc3ccccc3)c2)CCN1 |
| InChI | InChI=1S/C22H20N4O5S/c27-20-15-26(13-12-23-20)32(29,30)18-9-4-6-16(14-18)21(28)25-19-10-5-11-24-22(19)31-17-7-2-1-3-8-17/h1-11,14H,12-13,15H2,(H,23,27)(H,25,28) |
| InChIKey | FHQKSAOGZMOJKW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |