C17H15ClN2O5S — CID 134062109
(2-chlorophenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate (PubChem CID 134062109) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is (2-chlorophenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate.
| Compound Name | (2-chlorophenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 134062109 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2-chlorophenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)Oc3ccccc3Cl)c2)CCN1 |
| InChI | InChI=1S/C17H15ClN2O5S/c18-14-6-1-2-7-15(14)25-17(22)12-4-3-5-13(10-12)26(23,24)20-9-8-19-16(21)11-20/h1-7,10H,8-9,11H2,(H,19,21) |
| InChIKey | OGEDGQHABRLFEH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|