About (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate
(5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 8716504) has the molecular formula C20H17ClN2O4S
and a molecular weight of 416.89 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate |
| PubChem CID | 8716504 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(Oc1ccc(Cl)c2cccnc12)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H17ClN2O4S/c21-17-8-9-18(19-16(17)7-4-10-22-19)27-20(24)14-5-3-6-15(13-14)28(25,26)23-11-1-2-12-23/h3-10,13H,1-2,11-12H2 |
| InChIKey | JGFHFJZCGGVGRP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate?
The IUPAC name of (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate (CID 8716504) is (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate.
What is the SMILES notation for (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate?
The canonical SMILES for (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate is O=C(Oc1ccc(Cl)c2cccnc12)c1cccc(S(=O)(=O)N2CCCC2)c1.
What is the InChIKey of (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate?
The InChIKey is JGFHFJZCGGVGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O4S/c21-17-8-9-18(19-16(17)7-4-10-22-19)27-20(24)14-5-3-6-15(13-14)28(25,26)23-11-1-2-12-23/h3-10,13H,1-2,11-12H2.
What are the key properties of (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate?
(5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate has a molecular weight of 416.89 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloroquinolin-8-yl) 3-pyrrolidin-1-ylsulfonylbenzoate is sourced from PubChem (CID 8716504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).