C20H21Cl2NO4S — CID 4593615
(3,4-dichlorophenyl)methyl 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 4593615) has the molecular formula C20H21Cl2NO4S and a molecular weight of 442.36 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | (3,4-dichlorophenyl)methyl 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 4593615 |
| Molecular Formula | C20H21Cl2NO4S |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1ccc(Cl)c(Cl)c1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C20H21Cl2NO4S/c21-18-9-8-15(12-19(18)22)14-27-20(24)16-6-5-7-17(13-16)28(25,26)23-10-3-1-2-4-11-23/h5-9,12-13H,1-4,10-11,14H2 |
| InChIKey | BOIFEZBQTXIUNU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |