About (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate
(4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2715348) has the molecular formula C18H18BrNO4S
and a molecular weight of 424.32 g/mol. Its IUPAC name is (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| PubChem CID | 2715348 |
| Molecular Formula | C18H18BrNO4S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccc(Br)cc1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H18BrNO4S/c19-16-8-6-14(7-9-16)13-24-18(21)15-4-3-5-17(12-15)25(22,23)20-10-1-2-11-20/h3-9,12H,1-2,10-11,13H2 |
| InChIKey | WHLAAKRZQWDBAP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate?
The IUPAC name of (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate (CID 2715348) is (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate.
What is the SMILES notation for (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate?
The canonical SMILES for (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate is O=C(OCc1ccc(Br)cc1)c1cccc(S(=O)(=O)N2CCCC2)c1.
What is the InChIKey of (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate?
The InChIKey is WHLAAKRZQWDBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrNO4S/c19-16-8-6-14(7-9-16)13-24-18(21)15-4-3-5-17(12-15)25(22,23)20-10-1-2-11-20/h3-9,12H,1-2,10-11,13H2.
What are the key properties of (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate?
(4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate has a molecular weight of 424.32 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate is sourced from PubChem (CID 2715348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).