C20H23NO4S — CID 55334950
2-phenylethyl 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 55334950) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-phenylethyl 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-phenylethyl 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55334950 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-phenylethyl 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCCc1ccccc1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H23NO4S/c22-20(25-15-12-17-8-3-1-4-9-17)18-10-7-11-19(16-18)26(23,24)21-13-5-2-6-14-21/h1,3-4,7-11,16H,2,5-6,12-15H2 |
| InChIKey | MJPARPWURFKONV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |