C20H22ClNO4S — CID 1124170
2-phenylethyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 1124170) has the molecular formula C20H22ClNO4S and a molecular weight of 407.92 g/mol. Its IUPAC name is 2-phenylethyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-phenylethyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 1124170 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-phenylethyl 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCCc1ccccc1)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H22ClNO4S/c21-19-10-9-17(27(24,25)22-12-5-2-6-13-22)15-18(19)20(23)26-14-11-16-7-3-1-4-8-16/h1,3-4,7-10,15H,2,5-6,11-14H2 |
| InChIKey | QGGLQKPMXWYAOD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |