C20H22ClNO6S — CID 2662285
2-(4-methoxyphenyl)ethyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2662285) has the molecular formula C20H22ClNO6S and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 2-(4-methoxyphenyl)ethyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2662285 |
| Molecular Formula | C20H22ClNO6S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc(CCOC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO6S/c1-26-16-4-2-15(3-5-16)8-11-28-20(23)18-14-17(6-7-19(18)21)29(24,25)22-9-12-27-13-10-22/h2-7,14H,8-13H2,1H3 |
| InChIKey | SAGUSLUNFVWOLI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |