C19H20ClNO6S — CID 16578079
(4-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 16578079) has the molecular formula C19H20ClNO6S and a molecular weight of 425.89 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (4-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16578079 |
| Molecular Formula | C19H20ClNO6S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc(COC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO6S/c1-25-15-4-2-14(3-5-15)13-27-19(22)17-12-16(6-7-18(17)20)28(23,24)21-8-10-26-11-9-21/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | UQTQDNMPVCOBJY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |