C20H20FNO7S — CID 4263507
(4-methoxycarbonylphenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 4263507) has the molecular formula C20H20FNO7S and a molecular weight of 437.45 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (4-methoxycarbonylphenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4263507 |
| Molecular Formula | C20H20FNO7S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(COC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)cc1 |
| InChI | InChI=1S/C20H20FNO7S/c1-27-19(23)15-4-2-14(3-5-15)13-29-20(24)17-12-16(6-7-18(17)21)30(25,26)22-8-10-28-11-9-22/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | WTSCKSJUJGVRLQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |