C21H19FN2O5S2 — CID 16530468
(2-phenyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 16530468) has the molecular formula C21H19FN2O5S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16530468 |
| Molecular Formula | C21H19FN2O5S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C21H19FN2O5S2/c22-19-7-6-17(31(26,27)24-8-10-28-11-9-24)12-18(19)21(25)29-13-16-14-30-20(23-16)15-4-2-1-3-5-15/h1-7,12,14H,8-11,13H2 |
| InChIKey | DMNUQVGTPCZEEF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |