C21H21FN2O4S2 — CID 16512444
(2-phenyl-1,3-thiazol-4-yl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 16512444) has the molecular formula C21H21FN2O4S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 16512444 |
| Molecular Formula | C21H21FN2O4S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)OCc2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H21FN2O4S2/c1-3-24(4-2)30(26,27)17-10-11-19(22)18(12-17)21(25)28-13-16-14-29-20(23-16)15-8-6-5-7-9-15/h5-12,14H,3-4,13H2,1-2H3 |
| InChIKey | AFJVORRNLSOZGA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |