C17H19FN2O4S — CID 25311392
pyridin-2-ylmethyl 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 25311392) has the molecular formula C17H19FN2O4S and a molecular weight of 366.41 g/mol. Its IUPAC name is pyridin-2-ylmethyl 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | pyridin-2-ylmethyl 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 25311392 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | pyridin-2-ylmethyl 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)OCc2ccccn2)c1 |
| InChI | InChI=1S/C17H19FN2O4S/c1-3-20(4-2)25(22,23)14-8-9-16(18)15(11-14)17(21)24-12-13-7-5-6-10-19-13/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | WFURBPBKSROJAZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |