C19H21F2NO4S — CID 7252993
[(1R)-1-(4-fluorophenyl)ethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7252993) has the molecular formula C19H21F2NO4S and a molecular weight of 397.44 g/mol. Its IUPAC name is [(1R)-1-(4-fluorophenyl)ethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [(1R)-1-(4-fluorophenyl)ethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7252993 |
| Molecular Formula | C19H21F2NO4S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [(1R)-1-(4-fluorophenyl)ethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)O[C@H](C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H21F2NO4S/c1-4-22(5-2)27(24,25)16-10-11-18(21)17(12-16)19(23)26-13(3)14-6-8-15(20)9-7-14/h6-13H,4-5H2,1-3H3/t13-/m1/s1 |
| InChIKey | KIFPGOXCVFUKOP-CYBMUJFWSA-N |
| XLogP | 3.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |