C17H25FN2O5S — CID 8957998
[(2S)-1-oxo-1-(propylamino)propan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 8957998) has the molecular formula C17H25FN2O5S and a molecular weight of 388.46 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(propylamino)propan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 8957998 |
| Molecular Formula | C17H25FN2O5S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCCNC(=O)[C@H](C)OC(=O)c1cc(S(=O)(=O)N(CC)CC)ccc1F |
| InChI | InChI=1S/C17H25FN2O5S/c1-5-10-19-16(21)12(4)25-17(22)14-11-13(8-9-15(14)18)26(23,24)20(6-2)7-3/h8-9,11-12H,5-7,10H2,1-4H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | QFOASPQFQGQHMA-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |