C20H21ClFNO5S — CID 16560508
[1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 16560508) has the molecular formula C20H21ClFNO5S and a molecular weight of 441.91 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 16560508 |
| Molecular Formula | C20H21ClFNO5S |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)OC(C)C(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H21ClFNO5S/c1-4-23(5-2)29(26,27)16-10-11-18(22)17(12-16)20(25)28-13(3)19(24)14-6-8-15(21)9-7-14/h6-13H,4-5H2,1-3H3 |
| InChIKey | YQDKYACHRXDXAH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |