C20H22ClNO6S — CID 2524474
[(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2524474) has the molecular formula C20H22ClNO6S and a molecular weight of 439.92 g/mol. Its IUPAC name is [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2524474 |
| Molecular Formula | C20H22ClNO6S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CCOc1ccc(C(=O)[C@@H](C)OC(=O)c2cc(S(=O)(=O)N(C)C)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO6S/c1-5-27-15-8-6-14(7-9-15)19(23)13(2)28-20(24)17-12-16(10-11-18(17)21)29(25,26)22(3)4/h6-13H,5H2,1-4H3/t13-/m1/s1 |
| InChIKey | XTUFXICSMBTXCI-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |