C12H13ClN2O4S — CID 46792457
1-cyanoethyl 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 46792457) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is 1-cyanoethyl 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | 1-cyanoethyl 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46792457 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-cyanoethyl 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CC(C#N)OC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C12H13ClN2O4S/c1-8(7-14)19-12(16)10-6-9(4-5-11(10)13)20(17,18)15(2)3/h4-6,8H,1-3H3 |
| InChIKey | OTIGKBXKDQAFMG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |