C16H20ClN3O6S — CID 9383346
[(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 9383346) has the molecular formula C16H20ClN3O6S and a molecular weight of 417.87 g/mol. Its IUPAC name is [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 9383346 |
| Molecular Formula | C16H20ClN3O6S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1ccc(Cl)c(C(=O)O[C@@H](C)C(=O)N(C)CCC#N)c1 |
| InChI | InChI=1S/C16H20ClN3O6S/c1-11(15(21)19(2)9-5-8-18)26-16(22)13-10-12(6-7-14(13)17)27(23,24)20(3)25-4/h6-7,10-11H,5,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | VGPCHQHWQHLYRI-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|