C17H19BrN4O6S — CID 24530995
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-bromo-5-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 24530995) has the molecular formula C17H19BrN4O6S and a molecular weight of 487.33 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-bromo-5-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-bromo-5-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 24530995 |
| Molecular Formula | C17H19BrN4O6S |
| Molecular Weight | 487.33 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-bromo-5-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1ccc(Br)c(C(=O)OCC(=O)N(CCC#N)CCC#N)c1 |
| InChI | InChI=1S/C17H19BrN4O6S/c1-21(27-2)29(25,26)13-5-6-15(18)14(11-13)17(24)28-12-16(23)22(9-3-7-19)10-4-8-20/h5-6,11H,3-4,9-10,12H2,1-2H3 |
| InChIKey | SIJKJPKZJSDJDF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 140.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|