C18H23N3O6S — CID 7825329
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 7825329) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7825329 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)OCC(=O)N(C)CCC#N |
| InChI | InChI=1S/C18H23N3O6S/c1-14-4-5-15(28(24,25)21-8-10-26-11-9-21)12-16(14)18(23)27-13-17(22)20(2)7-3-6-19/h4-5,12H,3,7-11,13H2,1-2H3 |
| InChIKey | JMFRONJWDWMHDU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |