C21H31ClN2O6S — CID 16521150
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 16521150) has the molecular formula C21H31ClN2O6S and a molecular weight of 475.01 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16521150 |
| Molecular Formula | C21H31ClN2O6S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC(C)CN(CC(C)C)C(=O)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C21H31ClN2O6S/c1-15(2)12-23(13-16(3)4)20(25)14-30-21(26)18-11-17(5-6-19(18)22)31(27,28)24-7-9-29-10-8-24/h5-6,11,15-16H,7-10,12-14H2,1-4H3 |
| InChIKey | MELXOSCOMODEQZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |