C25H21ClN2O6S2 — CID 2367280
(2-oxo-2-phenothiazin-10-ylethyl) 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2367280) has the molecular formula C25H21ClN2O6S2 and a molecular weight of 545.04 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2367280 |
| Molecular Formula | C25H21ClN2O6S2 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCC(=O)N1c2ccccc2Sc2ccccc21)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C25H21ClN2O6S2/c26-19-10-9-17(36(31,32)27-11-13-33-14-12-27)15-18(19)25(30)34-16-24(29)28-20-5-1-3-7-22(20)35-23-8-4-2-6-21(23)28/h1-10,15H,11-14,16H2 |
| InChIKey | ZRLJTMAQANYDQO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |