C14H16ClNO6S — CID 7466290
(2-morpholin-4-yl-2-oxoethyl) 2-chloro-5-methylsulfonylbenzoate (PubChem CID 7466290) has the molecular formula C14H16ClNO6S and a molecular weight of 361.80 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7466290 |
| Molecular Formula | C14H16ClNO6S |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C14H16ClNO6S/c1-23(19,20)10-2-3-12(15)11(8-10)14(18)22-9-13(17)16-4-6-21-7-5-16/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | MBSNRVSTFSINBZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |