C15H19FN2O6S — CID 7976407
(2-morpholin-4-yl-2-oxoethyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976407) has the molecular formula C15H19FN2O6S and a molecular weight of 374.39 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976407 |
| Molecular Formula | C15H19FN2O6S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H19FN2O6S/c1-17(2)25(21,22)11-3-4-13(16)12(9-11)15(20)24-10-14(19)18-5-7-23-8-6-18/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | XNKGRKVBALRMGO-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |