C11H11FN2O4S — CID 7976390
cyanomethyl 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976390) has the molecular formula C11H11FN2O4S and a molecular weight of 286.28 g/mol. Its IUPAC name is cyanomethyl 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | cyanomethyl 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976390 |
| Molecular Formula | C11H11FN2O4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | cyanomethyl 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(F)c(C(=O)OCC#N)c1 |
| InChI | InChI=1S/C11H11FN2O4S/c1-14(2)19(16,17)8-3-4-10(12)9(7-8)11(15)18-6-5-13/h3-4,7H,6H2,1-2H3 |
| InChIKey | ADQQKOOGJUGPKU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |