C12H14FNO5S — CID 7976393
2-oxopropyl 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976393) has the molecular formula C12H14FNO5S and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-oxopropyl 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | 2-oxopropyl 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976393 |
| Molecular Formula | C12H14FNO5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-oxopropyl 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CC(=O)COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C12H14FNO5S/c1-8(15)7-19-12(16)10-6-9(4-5-11(10)13)20(17,18)14(2)3/h4-6H,7H2,1-3H3 |
| InChIKey | XXARQZIQJVUOIN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |