C18H17F2NO6S — CID 8569196
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 8569196) has the molecular formula C18H17F2NO6S and a molecular weight of 413.40 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 8569196 |
| Molecular Formula | C18H17F2NO6S |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(S(=O)(=O)N(C)C)ccc2F)cc1F |
| InChI | InChI=1S/C18H17F2NO6S/c1-21(2)28(24,25)12-5-6-14(19)13(9-12)18(23)27-10-16(22)11-4-7-17(26-3)15(20)8-11/h4-9H,10H2,1-3H3 |
| InChIKey | RHXJWMAGSUOENM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |