C17H15ClFNO5S — CID 2654385
[2-(4-fluorophenyl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2654385) has the molecular formula C17H15ClFNO5S and a molecular weight of 399.83 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2654385 |
| Molecular Formula | C17H15ClFNO5S |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H15ClFNO5S/c1-20(2)26(23,24)13-7-8-15(18)14(9-13)17(22)25-10-16(21)11-3-5-12(19)6-4-11/h3-9H,10H2,1-2H3 |
| InChIKey | FKWHZAHYBKQXSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |