C22H16ClF2NO5S — CID 29243383
[2-(2-fluorophenyl)-2-oxoethyl] 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate (PubChem CID 29243383) has the molecular formula C22H16ClF2NO5S and a molecular weight of 479.89 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 29243383 |
| Molecular Formula | C22H16ClF2NO5S |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate |
| SMILES | CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C22H16ClF2NO5S/c1-26(15-8-6-14(24)7-9-15)32(29,30)16-10-11-19(23)18(12-16)22(28)31-13-21(27)17-4-2-3-5-20(17)25/h2-12H,13H2,1H3 |
| InChIKey | VZVCYIYFFDZOJM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |