C23H20ClFN2O5S — CID 30804474
methyl 3-[[2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoyl]amino]-2-methylbenzoate (PubChem CID 30804474) has the molecular formula C23H20ClFN2O5S and a molecular weight of 490.94 g/mol. Its IUPAC name is methyl 3-[[2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoyl]amino]-2-methylbenzoate.
| Compound Name | methyl 3-[[2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoyl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 30804474 |
| Molecular Formula | C23H20ClFN2O5S |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | methyl 3-[[2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoyl]amino]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cc(S(=O)(=O)N(C)c3ccc(F)cc3)ccc2Cl)c1C |
| InChI | InChI=1S/C23H20ClFN2O5S/c1-14-18(23(29)32-3)5-4-6-21(14)26-22(28)19-13-17(11-12-20(19)24)33(30,31)27(2)16-9-7-15(25)8-10-16/h4-13H,1-3H3,(H,26,28) |
| InChIKey | CVWWABBMOISSGD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |