C22H20ClFN2O5S — CID 2709372
2-chloro-N-(2,4-dimethoxyphenyl)-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide (PubChem CID 2709372) has the molecular formula C22H20ClFN2O5S and a molecular weight of 478.93 g/mol. Its IUPAC name is 2-chloro-N-(2,4-dimethoxyphenyl)-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide.
| Compound Name | 2-chloro-N-(2,4-dimethoxyphenyl)-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 2709372 |
| Molecular Formula | C22H20ClFN2O5S |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-chloro-N-(2,4-dimethoxyphenyl)-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(S(=O)(=O)N(C)c3ccc(F)cc3)ccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H20ClFN2O5S/c1-26(15-6-4-14(24)5-7-15)32(28,29)17-9-10-19(23)18(13-17)22(27)25-20-11-8-16(30-2)12-21(20)31-3/h4-13H,1-3H3,(H,25,27) |
| InChIKey | WLIWZRJUEGSPNW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |