C23H23ClFN3O3S — CID 55780312
2-chloro-N-[4-(dimethylamino)-2-methylphenyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide (PubChem CID 55780312) has the molecular formula C23H23ClFN3O3S and a molecular weight of 475.97 g/mol. Its IUPAC name is 2-chloro-N-[4-(dimethylamino)-2-methylphenyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide.
| Compound Name | 2-chloro-N-[4-(dimethylamino)-2-methylphenyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 55780312 |
| Molecular Formula | C23H23ClFN3O3S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2-chloro-N-[4-(dimethylamino)-2-methylphenyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)c1cc(S(=O)(=O)N(C)c2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C23H23ClFN3O3S/c1-15-13-18(27(2)3)9-12-22(15)26-23(29)20-14-19(10-11-21(20)24)32(30,31)28(4)17-7-5-16(25)6-8-17/h5-14H,1-4H3,(H,26,29) |
| InChIKey | WKUZAZSLPNCCBI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|