C19H22ClFN2O3S — CID 27659841
2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-pentylbenzamide (PubChem CID 27659841) has the molecular formula C19H22ClFN2O3S and a molecular weight of 412.91 g/mol. Its IUPAC name is 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-pentylbenzamide.
| Compound Name | 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 27659841 |
| Molecular Formula | C19H22ClFN2O3S |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cc(S(=O)(=O)N(C)c2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C19H22ClFN2O3S/c1-3-4-5-12-22-19(24)17-13-16(10-11-18(17)20)27(25,26)23(2)15-8-6-14(21)7-9-15/h6-11,13H,3-5,12H2,1-2H3,(H,22,24) |
| InChIKey | SFTWIUWZRZFCBR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|