C23H27ClFN3O4S — CID 55805861
2-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide (PubChem CID 55805861) has the molecular formula C23H27ClFN3O4S and a molecular weight of 496.00 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide.
| Compound Name | 2-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 55805861 |
| Molecular Formula | C23H27ClFN3O4S |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-5-[(4-fluorophenyl)-methylsulfamoyl]benzamide |
| SMILES | CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)NCCNC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H27ClFN3O4S/c1-28(18-9-7-17(25)8-10-18)33(31,32)19-11-12-21(24)20(15-19)23(30)27-14-13-26-22(29)16-5-3-2-4-6-16/h7-12,15-16H,2-6,13-14H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | LIKZHXPOHSJPJU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|