C22H22ClFN2O5S — CID 55471264
2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-[3-(furan-2-ylmethoxy)propyl]benzamide (PubChem CID 55471264) has the molecular formula C22H22ClFN2O5S and a molecular weight of 480.95 g/mol. Its IUPAC name is 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-[3-(furan-2-ylmethoxy)propyl]benzamide.
| Compound Name | 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-[3-(furan-2-ylmethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55471264 |
| Molecular Formula | C22H22ClFN2O5S |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]-N-[3-(furan-2-ylmethoxy)propyl]benzamide |
| SMILES | CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)NCCCOCc2ccco2)c1 |
| InChI | InChI=1S/C22H22ClFN2O5S/c1-26(17-7-5-16(24)6-8-17)32(28,29)19-9-10-21(23)20(14-19)22(27)25-11-3-12-30-15-18-4-2-13-31-18/h2,4-10,13-14H,3,11-12,15H2,1H3,(H,25,27) |
| InChIKey | VJXMXQUAZQZANI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|